C13H12NO5- — CID 4280353
4-[(4-methoxycarbonylphenyl)methylamino]-4-oxobut-2-enoate (PubChem CID 4280353) has the molecular formula C13H12NO5- and a molecular weight of 262.24 g/mol. Its IUPAC name is 4-[(4-methoxycarbonylphenyl)methylamino]-4-oxobut-2-enoate.
| Compound Name | 4-[(4-methoxycarbonylphenyl)methylamino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 4280353 |
| Molecular Formula | C13H12NO5- |
| Molecular Weight | 262.24 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 4-[(4-methoxycarbonylphenyl)methylamino]-4-oxobut-2-enoate |
| SMILES | COC(=O)c1ccc(CNC(=O)C=CC(=O)[O-])cc1 |
| InChI | InChI=1S/C13H13NO5/c1-19-13(18)10-4-2-9(3-5-10)8-14-11(15)6-7-12(16)17/h2-7H,8H2,1H3,(H,14,15)(H,16,17)/p-1 |
| InChIKey | FITVIIMKYDURQV-UHFFFAOYSA-M |
| XLogP | -0.60 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.24 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|