C12H12N2O3 — CID 55164654
5-[[(2E,4E)-hexa-2,4-dienoyl]amino]pyridine-3-carboxylic acid (PubChem CID 55164654) has the molecular formula C12H12N2O3 and a molecular weight of 232.24 g/mol. Its IUPAC name is 5-[[(2E,4E)-hexa-2,4-dienoyl]amino]pyridine-3-carboxylic acid.
| Compound Name | 5-[[(2E,4E)-hexa-2,4-dienoyl]amino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 55164654 |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 5-[[(2E,4E)-hexa-2,4-dienoyl]amino]pyridine-3-carboxylic acid |
| SMILES | C/C=C/C=C/C(=O)Nc1cncc(C(=O)O)c1 |
| InChI | InChI=1S/C12H12N2O3/c1-2-3-4-5-11(15)14-10-6-9(12(16)17)7-13-8-10/h2-8H,1H3,(H,14,15)(H,16,17)/b3-2+,5-4+ |
| InChIKey | RKQPKUKHYZXZOD-MQQKCMAXSA-N |
| XLogP | 1.85 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|