C12H15N4OS+ — CID 155924019
trimethyl-[(4-pyridin-2-yl-1,3-thiazol-2-yl)carbamoyl]azanium (PubChem CID 155924019) has the molecular formula C12H15N4OS+ and a molecular weight of 263.35 g/mol. Its IUPAC name is trimethyl-[(4-pyridin-2-yl-1,3-thiazol-2-yl)carbamoyl]azanium.
| Compound Name | trimethyl-[(4-pyridin-2-yl-1,3-thiazol-2-yl)carbamoyl]azanium |
|---|---|
| PubChem CID | 155924019 |
| Molecular Formula | C12H15N4OS+ |
| Molecular Weight | 263.35 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | trimethyl-[(4-pyridin-2-yl-1,3-thiazol-2-yl)carbamoyl]azanium |
| SMILES | C[N+](C)(C)C(=O)Nc1nc(-c2ccccn2)cs1 |
| InChI | InChI=1S/C12H14N4OS/c1-16(2,3)12(17)15-11-14-10(8-18-11)9-6-4-5-7-13-9/h4-8H,1-3H3/p+1 |
| InChIKey | WCNAZCMOCXLNTJ-UHFFFAOYSA-O |
| XLogP | 2.44 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|