C18H23N3O2S2 — CID 71854547
4-methyl-2-[3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoylamino]-5-pentylthiophene-3-carboxamide (PubChem CID 71854547) has the molecular formula C18H23N3O2S2 and a molecular weight of 377.54 g/mol. Its IUPAC name is 4-methyl-2-[3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoylamino]-5-pentylthiophene-3-carboxamide.
| Compound Name | 4-methyl-2-[3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoylamino]-5-pentylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 71854547 |
| Molecular Formula | C18H23N3O2S2 |
| Molecular Weight | 377.54 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 4-methyl-2-[3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoylamino]-5-pentylthiophene-3-carboxamide |
| SMILES | CCCCCc1sc(NC(=O)C=Cc2csc(C)n2)c(C(N)=O)c1C |
| InChI | InChI=1S/C18H23N3O2S2/c1-4-5-6-7-14-11(2)16(17(19)23)18(25-14)21-15(22)9-8-13-10-24-12(3)20-13/h8-10H,4-7H2,1-3H3,(H2,19,23)(H,21,22) |
| InChIKey | PEBKBNYCYKZNCP-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.54 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|