C16H18N2O3S2 — CID 16582911
ethyl 4,5-dimethyl-2-[[(E)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoyl]amino]thiophene-3-carboxylate (PubChem CID 16582911) has the molecular formula C16H18N2O3S2 and a molecular weight of 350.47 g/mol. Its IUPAC name is ethyl 4,5-dimethyl-2-[[(E)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4,5-dimethyl-2-[[(E)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 16582911 |
| Molecular Formula | C16H18N2O3S2 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | ethyl 4,5-dimethyl-2-[[(E)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)/C=C/c2csc(C)n2)sc(C)c1C |
| InChI | InChI=1S/C16H18N2O3S2/c1-5-21-16(20)14-9(2)10(3)23-15(14)18-13(19)7-6-12-8-22-11(4)17-12/h6-8H,5H2,1-4H3,(H,18,19)/b7-6+ |
| InChIKey | HYPUPUWZRXNNHX-VOTSOKGWSA-N |
| XLogP | 3.96 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|