C16H16BrNO3S2 — CID 16547341
ethyl 2-[[(E)-3-(5-bromothiophen-2-yl)prop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate (PubChem CID 16547341) has the molecular formula C16H16BrNO3S2 and a molecular weight of 414.35 g/mol. Its IUPAC name is ethyl 2-[[(E)-3-(5-bromothiophen-2-yl)prop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(E)-3-(5-bromothiophen-2-yl)prop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 16547341 |
| Molecular Formula | C16H16BrNO3S2 |
| Molecular Weight | 414.35 g/mol |
| Exact Mass | 412.98 |
| IUPAC Name | ethyl 2-[[(E)-3-(5-bromothiophen-2-yl)prop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)/C=C/c2ccc(Br)s2)sc(C)c1C |
| InChI | InChI=1S/C16H16BrNO3S2/c1-4-21-16(20)14-9(2)10(3)22-15(14)18-13(19)8-6-11-5-7-12(17)23-11/h5-8H,4H2,1-3H3,(H,18,19)/b8-6+ |
| InChIKey | FGAAFKUFYAGCQZ-SOFGYWHQSA-N |
| XLogP | 5.02 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.35 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|