C16H17N3O4S — CID 47085141
4,5-dimethoxy-2-[[(E)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoyl]amino]benzamide (PubChem CID 47085141) has the molecular formula C16H17N3O4S and a molecular weight of 347.40 g/mol. Its IUPAC name is 4,5-dimethoxy-2-[[(E)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoyl]amino]benzamide.
| Compound Name | 4,5-dimethoxy-2-[[(E)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoyl]amino]benzamide |
|---|---|
| PubChem CID | 47085141 |
| Molecular Formula | C16H17N3O4S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 4,5-dimethoxy-2-[[(E)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoyl]amino]benzamide |
| SMILES | COc1cc(NC(=O)/C=C/c2csc(C)n2)c(C(N)=O)cc1OC |
| InChI | InChI=1S/C16H17N3O4S/c1-9-18-10(8-24-9)4-5-15(20)19-12-7-14(23-3)13(22-2)6-11(12)16(17)21/h4-8H,1-3H3,(H2,17,21)(H,19,20)/b5-4+ |
| InChIKey | JDHSBLMLFVKNEX-SNAWJCMRSA-N |
| XLogP | 2.22 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|