C21H24N2O7 — CID 54112532
4,5-dimethoxy-2-[3-(3,4,5-trimethoxyphenyl)prop-2-enoylamino]benzamide (PubChem CID 54112532) has the molecular formula C21H24N2O7 and a molecular weight of 416.43 g/mol. Its IUPAC name is 4,5-dimethoxy-2-[3-(3,4,5-trimethoxyphenyl)prop-2-enoylamino]benzamide.
| Compound Name | 4,5-dimethoxy-2-[3-(3,4,5-trimethoxyphenyl)prop-2-enoylamino]benzamide |
|---|---|
| PubChem CID | 54112532 |
| Molecular Formula | C21H24N2O7 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 4,5-dimethoxy-2-[3-(3,4,5-trimethoxyphenyl)prop-2-enoylamino]benzamide |
| SMILES | COc1cc(NC(=O)C=Cc2cc(OC)c(OC)c(OC)c2)c(C(N)=O)cc1OC |
| InChI | InChI=1S/C21H24N2O7/c1-26-15-10-13(21(22)25)14(11-16(15)27-2)23-19(24)7-6-12-8-17(28-3)20(30-5)18(9-12)29-4/h6-11H,1-5H3,(H2,22,25)(H,23,24) |
| InChIKey | NICJGQOYNKKFHS-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 118.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|