C9H8N2O4S — CID 6118974
(E)-4-[(3-carbamoylthiophen-2-yl)amino]-4-oxobut-2-enoic acid (PubChem CID 6118974) has the molecular formula C9H8N2O4S and a molecular weight of 240.24 g/mol. Its IUPAC name is (E)-4-[(3-carbamoylthiophen-2-yl)amino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[(3-carbamoylthiophen-2-yl)amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 6118974 |
| Molecular Formula | C9H8N2O4S |
| Molecular Weight | 240.24 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | (E)-4-[(3-carbamoylthiophen-2-yl)amino]-4-oxobut-2-enoic acid |
| SMILES | NC(=O)c1ccsc1NC(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C9H8N2O4S/c10-8(15)5-3-4-16-9(5)11-6(12)1-2-7(13)14/h1-4H,(H2,10,15)(H,11,12)(H,13,14)/b2-1+ |
| InChIKey | INXMDZKSADHIPR-OWOJBTEDSA-N |
| XLogP | 0.43 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.24 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|