C19H20N2O6S — CID 17377592
(E)-4-[[3-[2-(3,4-dimethoxyphenyl)ethylcarbamoyl]thiophen-2-yl]amino]-4-oxobut-2-enoic acid (PubChem CID 17377592) has the molecular formula C19H20N2O6S and a molecular weight of 404.44 g/mol. Its IUPAC name is (E)-4-[[3-[2-(3,4-dimethoxyphenyl)ethylcarbamoyl]thiophen-2-yl]amino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[[3-[2-(3,4-dimethoxyphenyl)ethylcarbamoyl]thiophen-2-yl]amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 17377592 |
| Molecular Formula | C19H20N2O6S |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | (E)-4-[[3-[2-(3,4-dimethoxyphenyl)ethylcarbamoyl]thiophen-2-yl]amino]-4-oxobut-2-enoic acid |
| SMILES | COc1ccc(CCNC(=O)c2ccsc2NC(=O)/C=C/C(=O)O)cc1OC |
| InChI | InChI=1S/C19H20N2O6S/c1-26-14-4-3-12(11-15(14)27-2)7-9-20-18(25)13-8-10-28-19(13)21-16(22)5-6-17(23)24/h3-6,8,10-11H,7,9H2,1-2H3,(H,20,25)(H,21,22)(H,23,24)/b6-5+ |
| InChIKey | HYPBGPHLOBKRBP-AATRIKPKSA-N |
| XLogP | 2.32 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|