C17H10BrCl2NO3S2 — CID 2167835
methyl 2-[(5-bromothiophene-2-carbonyl)amino]-4-(2,4-dichlorophenyl)thiophene-3-carboxylate (PubChem CID 2167835) has the molecular formula C17H10BrCl2NO3S2 and a molecular weight of 491.22 g/mol. Its IUPAC name is methyl 2-[(5-bromothiophene-2-carbonyl)amino]-4-(2,4-dichlorophenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[(5-bromothiophene-2-carbonyl)amino]-4-(2,4-dichlorophenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 2167835 |
| Molecular Formula | C17H10BrCl2NO3S2 |
| Molecular Weight | 491.22 g/mol |
| Exact Mass | 488.87 |
| IUPAC Name | methyl 2-[(5-bromothiophene-2-carbonyl)amino]-4-(2,4-dichlorophenyl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(Cl)cc2Cl)csc1NC(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C17H10BrCl2NO3S2/c1-24-17(23)14-10(9-3-2-8(19)6-11(9)20)7-25-16(14)21-15(22)12-4-5-13(18)26-12/h2-7H,1H3,(H,21,22) |
| InChIKey | WIBNDLUOVCJBSM-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.22 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|