C18H14Cl2NO5S- — CID 4748721
4-[[4-(2,4-dichlorophenyl)-3-propan-2-yloxycarbonylthiophen-2-yl]amino]-4-oxobut-2-enoate (PubChem CID 4748721) has the molecular formula C18H14Cl2NO5S- and a molecular weight of 427.29 g/mol. Its IUPAC name is 4-[[4-(2,4-dichlorophenyl)-3-propan-2-yloxycarbonylthiophen-2-yl]amino]-4-oxobut-2-enoate.
| Compound Name | 4-[[4-(2,4-dichlorophenyl)-3-propan-2-yloxycarbonylthiophen-2-yl]amino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 4748721 |
| Molecular Formula | C18H14Cl2NO5S- |
| Molecular Weight | 427.29 g/mol |
| Exact Mass | 426.00 |
| IUPAC Name | 4-[[4-(2,4-dichlorophenyl)-3-propan-2-yloxycarbonylthiophen-2-yl]amino]-4-oxobut-2-enoate |
| SMILES | CC(C)OC(=O)c1c(-c2ccc(Cl)cc2Cl)csc1NC(=O)C=CC(=O)[O-] |
| InChI | InChI=1S/C18H15Cl2NO5S/c1-9(2)26-18(25)16-12(11-4-3-10(19)7-13(11)20)8-27-17(16)21-14(22)5-6-15(23)24/h3-9H,1-2H3,(H,21,22)(H,23,24)/p-1 |
| InChIKey | QZJQGUNBHDBJHX-UHFFFAOYSA-M |
| XLogP | 3.53 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.29 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|