C30H28ClNO4S — CID 5114749
propan-2-yl 2-[[2-(4-chlorophenoxy)-2-methylpropanoyl]amino]-4-(4-phenylphenyl)thiophene-3-carboxylate (PubChem CID 5114749) has the molecular formula C30H28ClNO4S and a molecular weight of 534.08 g/mol. Its IUPAC name is propan-2-yl 2-[[2-(4-chlorophenoxy)-2-methylpropanoyl]amino]-4-(4-phenylphenyl)thiophene-3-carboxylate.
| Compound Name | propan-2-yl 2-[[2-(4-chlorophenoxy)-2-methylpropanoyl]amino]-4-(4-phenylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 5114749 |
| Molecular Formula | C30H28ClNO4S |
| Molecular Weight | 534.08 g/mol |
| Exact Mass | 533.14 |
| IUPAC Name | propan-2-yl 2-[[2-(4-chlorophenoxy)-2-methylpropanoyl]amino]-4-(4-phenylphenyl)thiophene-3-carboxylate |
| SMILES | CC(C)OC(=O)c1c(-c2ccc(-c3ccccc3)cc2)csc1NC(=O)C(C)(C)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H28ClNO4S/c1-19(2)35-28(33)26-25(22-12-10-21(11-13-22)20-8-6-5-7-9-20)18-37-27(26)32-29(34)30(3,4)36-24-16-14-23(31)15-17-24/h5-19H,1-4H3,(H,32,34) |
| InChIKey | XZSBGWNSEREOMG-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.08 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|