About propan-2-yl 2-amino-4-(2,4-dichloro-5-fluorophenyl)thiophene-3-carboxylate
propan-2-yl 2-amino-4-(2,4-dichloro-5-fluorophenyl)thiophene-3-carboxylate (PubChem CID 63472842) has the molecular formula C14H12Cl2FNO2S
and a molecular weight of 348.23 g/mol. Its IUPAC name is propan-2-yl 2-amino-4-(2,4-dichloro-5-fluorophenyl)thiophene-3-carboxylate.
Molecular Properties
| Compound Name | propan-2-yl 2-amino-4-(2,4-dichloro-5-fluorophenyl)thiophene-3-carboxylate |
| PubChem CID | 63472842 |
| Molecular Formula | C14H12Cl2FNO2S |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 346.99 |
| IUPAC Name | propan-2-yl 2-amino-4-(2,4-dichloro-5-fluorophenyl)thiophene-3-carboxylate |
| SMILES | CC(C)OC(=O)c1c(-c2cc(F)c(Cl)cc2Cl)csc1N |
| InChI | InChI=1S/C14H12Cl2FNO2S/c1-6(2)20-14(19)12-8(5-21-13(12)18)7-3-11(17)10(16)4-9(7)15/h3-6H,18H2,1-2H3 |
| InChIKey | YCVPMCGCDHXCDH-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl 2-amino-4-(2,4-dichloro-5-fluorophenyl)thiophene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-amino-4-(2,4-dichloro-5-fluorophenyl)thiophene-3-carboxylate?
The IUPAC name of propan-2-yl 2-amino-4-(2,4-dichloro-5-fluorophenyl)thiophene-3-carboxylate (CID 63472842) is propan-2-yl 2-amino-4-(2,4-dichloro-5-fluorophenyl)thiophene-3-carboxylate.
What is the SMILES notation for propan-2-yl 2-amino-4-(2,4-dichloro-5-fluorophenyl)thiophene-3-carboxylate?
The canonical SMILES for propan-2-yl 2-amino-4-(2,4-dichloro-5-fluorophenyl)thiophene-3-carboxylate is CC(C)OC(=O)c1c(-c2cc(F)c(Cl)cc2Cl)csc1N.
What is the InChIKey of propan-2-yl 2-amino-4-(2,4-dichloro-5-fluorophenyl)thiophene-3-carboxylate?
The InChIKey is YCVPMCGCDHXCDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12Cl2FNO2S/c1-6(2)20-14(19)12-8(5-21-13(12)18)7-3-11(17)10(16)4-9(7)15/h3-6H,18H2,1-2H3.
What are the key properties of propan-2-yl 2-amino-4-(2,4-dichloro-5-fluorophenyl)thiophene-3-carboxylate?
propan-2-yl 2-amino-4-(2,4-dichloro-5-fluorophenyl)thiophene-3-carboxylate has a molecular weight of 348.23 g/mol, XLogP of 5.01, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-amino-4-(2,4-dichloro-5-fluorophenyl)thiophene-3-carboxylate is sourced from PubChem (CID 63472842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).