C14H12Cl2FNO2S — CID 63472842
propan-2-yl 2-amino-4-(2,4-dichloro-5-fluorophenyl)thiophene-3-carboxylate (PubChem CID 63472842) has the molecular formula C14H12Cl2FNO2S and a molecular weight of 348.23 g/mol. Its IUPAC name is propan-2-yl 2-amino-4-(2,4-dichloro-5-fluorophenyl)thiophene-3-carboxylate.
| Compound Name | propan-2-yl 2-amino-4-(2,4-dichloro-5-fluorophenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 63472842 |
| Molecular Formula | C14H12Cl2FNO2S |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 346.99 |
| IUPAC Name | propan-2-yl 2-amino-4-(2,4-dichloro-5-fluorophenyl)thiophene-3-carboxylate |
| SMILES | CC(C)OC(=O)c1c(-c2cc(F)c(Cl)cc2Cl)csc1N |
| InChI | InChI=1S/C14H12Cl2FNO2S/c1-6(2)20-14(19)12-8(5-21-13(12)18)7-3-11(17)10(16)4-9(7)15/h3-6H,18H2,1-2H3 |
| InChIKey | YCVPMCGCDHXCDH-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|