C10H11F2NO2 — CID 60836795
propan-2-yl 2-amino-3,6-difluorobenzoate (PubChem CID 60836795) has the molecular formula C10H11F2NO2 and a molecular weight of 215.20 g/mol. Its IUPAC name is propan-2-yl 2-amino-3,6-difluorobenzoate.
| Compound Name | propan-2-yl 2-amino-3,6-difluorobenzoate |
|---|---|
| PubChem CID | 60836795 |
| Molecular Formula | C10H11F2NO2 |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | propan-2-yl 2-amino-3,6-difluorobenzoate |
| SMILES | CC(C)OC(=O)c1c(F)ccc(F)c1N |
| InChI | InChI=1S/C10H11F2NO2/c1-5(2)15-10(14)8-6(11)3-4-7(12)9(8)13/h3-5H,13H2,1-2H3 |
| InChIKey | ZGJWFDZTLPQTPB-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|