About butan-2-yl 2-amino-6-fluorobenzoate
butan-2-yl 2-amino-6-fluorobenzoate (PubChem CID 60904386) has the molecular formula C11H14FNO2
and a molecular weight of 211.24 g/mol. Its IUPAC name is butan-2-yl 2-amino-6-fluorobenzoate.
Molecular Properties
| Compound Name | butan-2-yl 2-amino-6-fluorobenzoate |
| PubChem CID | 60904386 |
| Molecular Formula | C11H14FNO2 |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | butan-2-yl 2-amino-6-fluorobenzoate |
| SMILES | CCC(C)OC(=O)c1c(N)cccc1F |
| InChI | InChI=1S/C11H14FNO2/c1-3-7(2)15-11(14)10-8(12)5-4-6-9(10)13/h4-7H,3,13H2,1-2H3 |
| InChIKey | FPZHKEJHDJDRQT-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze butan-2-yl 2-amino-6-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-yl 2-amino-6-fluorobenzoate?
The IUPAC name of butan-2-yl 2-amino-6-fluorobenzoate (CID 60904386) is butan-2-yl 2-amino-6-fluorobenzoate.
What is the SMILES notation for butan-2-yl 2-amino-6-fluorobenzoate?
The canonical SMILES for butan-2-yl 2-amino-6-fluorobenzoate is CCC(C)OC(=O)c1c(N)cccc1F.
What is the InChIKey of butan-2-yl 2-amino-6-fluorobenzoate?
The InChIKey is FPZHKEJHDJDRQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14FNO2/c1-3-7(2)15-11(14)10-8(12)5-4-6-9(10)13/h4-7H,3,13H2,1-2H3.
What are the key properties of butan-2-yl 2-amino-6-fluorobenzoate?
butan-2-yl 2-amino-6-fluorobenzoate has a molecular weight of 211.24 g/mol, XLogP of 2.36, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-yl 2-amino-6-fluorobenzoate is sourced from PubChem (CID 60904386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).