About thiophen-2-ylmethyl 2-amino-6-fluorobenzoate
thiophen-2-ylmethyl 2-amino-6-fluorobenzoate (PubChem CID 61233744) has the molecular formula C12H10FNO2S
and a molecular weight of 251.28 g/mol. Its IUPAC name is thiophen-2-ylmethyl 2-amino-6-fluorobenzoate.
Molecular Properties
| Compound Name | thiophen-2-ylmethyl 2-amino-6-fluorobenzoate |
| PubChem CID | 61233744 |
| Molecular Formula | C12H10FNO2S |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | thiophen-2-ylmethyl 2-amino-6-fluorobenzoate |
| SMILES | Nc1cccc(F)c1C(=O)OCc1cccs1 |
| InChI | InChI=1S/C12H10FNO2S/c13-9-4-1-5-10(14)11(9)12(15)16-7-8-3-2-6-17-8/h1-6H,7,14H2 |
| InChIKey | PYFZFQDDGRTSQM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze thiophen-2-ylmethyl 2-amino-6-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiophen-2-ylmethyl 2-amino-6-fluorobenzoate?
The IUPAC name of thiophen-2-ylmethyl 2-amino-6-fluorobenzoate (CID 61233744) is thiophen-2-ylmethyl 2-amino-6-fluorobenzoate.
What is the SMILES notation for thiophen-2-ylmethyl 2-amino-6-fluorobenzoate?
The canonical SMILES for thiophen-2-ylmethyl 2-amino-6-fluorobenzoate is Nc1cccc(F)c1C(=O)OCc1cccs1.
What is the InChIKey of thiophen-2-ylmethyl 2-amino-6-fluorobenzoate?
The InChIKey is PYFZFQDDGRTSQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10FNO2S/c13-9-4-1-5-10(14)11(9)12(15)16-7-8-3-2-6-17-8/h1-6H,7,14H2.
What are the key properties of thiophen-2-ylmethyl 2-amino-6-fluorobenzoate?
thiophen-2-ylmethyl 2-amino-6-fluorobenzoate has a molecular weight of 251.28 g/mol, XLogP of 2.83, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for thiophen-2-ylmethyl 2-amino-6-fluorobenzoate is sourced from PubChem (CID 61233744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).