C13H12F2N2OS — CID 79773779
3-amino-2,6-difluoro-N-(2-thiophen-2-ylethyl)benzamide (PubChem CID 79773779) has the molecular formula C13H12F2N2OS and a molecular weight of 282.31 g/mol. Its IUPAC name is 3-amino-2,6-difluoro-N-(2-thiophen-2-ylethyl)benzamide.
| Compound Name | 3-amino-2,6-difluoro-N-(2-thiophen-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 79773779 |
| Molecular Formula | C13H12F2N2OS |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 3-amino-2,6-difluoro-N-(2-thiophen-2-ylethyl)benzamide |
| SMILES | Nc1ccc(F)c(C(=O)NCCc2cccs2)c1F |
| InChI | InChI=1S/C13H12F2N2OS/c14-9-3-4-10(16)12(15)11(9)13(18)17-6-5-8-2-1-7-19-8/h1-4,7H,5-6,16H2,(H,17,18) |
| InChIKey | CPMFJKSMJZUAKI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|