C11H12N2OS2 — CID 61090030
3-amino-N-(2-thiophen-2-ylethyl)thiophene-2-carboxamide (PubChem CID 61090030) has the molecular formula C11H12N2OS2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 3-amino-N-(2-thiophen-2-ylethyl)thiophene-2-carboxamide.
| Compound Name | 3-amino-N-(2-thiophen-2-ylethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 61090030 |
| Molecular Formula | C11H12N2OS2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 3-amino-N-(2-thiophen-2-ylethyl)thiophene-2-carboxamide |
| SMILES | Nc1ccsc1C(=O)NCCc1cccs1 |
| InChI | InChI=1S/C11H12N2OS2/c12-9-4-7-16-10(9)11(14)13-5-3-8-2-1-6-15-8/h1-2,4,6-7H,3,5,12H2,(H,13,14) |
| InChIKey | AFDXTMNMHVIRCN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |