C10H11F2N3O3 — CID 83202374
2-[(3-amino-2,6-difluorobenzoyl)amino]ethyl carbamate (PubChem CID 83202374) has the molecular formula C10H11F2N3O3 and a molecular weight of 259.21 g/mol. Its IUPAC name is 2-[(3-amino-2,6-difluorobenzoyl)amino]ethyl carbamate.
| Compound Name | 2-[(3-amino-2,6-difluorobenzoyl)amino]ethyl carbamate |
|---|---|
| PubChem CID | 83202374 |
| Molecular Formula | C10H11F2N3O3 |
| Molecular Weight | 259.21 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 2-[(3-amino-2,6-difluorobenzoyl)amino]ethyl carbamate |
| SMILES | NC(=O)OCCNC(=O)c1c(F)ccc(N)c1F |
| InChI | InChI=1S/C10H11F2N3O3/c11-5-1-2-6(13)8(12)7(5)9(16)15-3-4-18-10(14)17/h1-2H,3-4,13H2,(H2,14,17)(H,15,16) |
| InChIKey | VOCIGIOFXWRIDL-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.21 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|