About propan-2-yl 2-amino-4-[3,4-bis(hydroxymethyl)phenyl]thiophene-3-carboxylate
propan-2-yl 2-amino-4-[3,4-bis(hydroxymethyl)phenyl]thiophene-3-carboxylate (PubChem CID 71076017) has the molecular formula C16H19NO4S
and a molecular weight of 321.40 g/mol. Its IUPAC name is propan-2-yl 2-amino-4-[3,4-bis(hydroxymethyl)phenyl]thiophene-3-carboxylate.
Molecular Properties
| Compound Name | propan-2-yl 2-amino-4-[3,4-bis(hydroxymethyl)phenyl]thiophene-3-carboxylate |
| PubChem CID | 71076017 |
| Molecular Formula | C16H19NO4S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | propan-2-yl 2-amino-4-[3,4-bis(hydroxymethyl)phenyl]thiophene-3-carboxylate |
| SMILES | CC(C)OC(=O)c1c(-c2ccc(CO)c(CO)c2)csc1N |
| InChI | InChI=1S/C16H19NO4S/c1-9(2)21-16(20)14-13(8-22-15(14)17)10-3-4-11(6-18)12(5-10)7-19/h3-5,8-9,18-19H,6-7,17H2,1-2H3 |
| InChIKey | YYWBPSYCWFLOLE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze propan-2-yl 2-amino-4-[3,4-bis(hydroxymethyl)phenyl]thiophene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-amino-4-[3,4-bis(hydroxymethyl)phenyl]thiophene-3-carboxylate?
The IUPAC name of propan-2-yl 2-amino-4-[3,4-bis(hydroxymethyl)phenyl]thiophene-3-carboxylate (CID 71076017) is propan-2-yl 2-amino-4-[3,4-bis(hydroxymethyl)phenyl]thiophene-3-carboxylate.
What is the SMILES notation for propan-2-yl 2-amino-4-[3,4-bis(hydroxymethyl)phenyl]thiophene-3-carboxylate?
The canonical SMILES for propan-2-yl 2-amino-4-[3,4-bis(hydroxymethyl)phenyl]thiophene-3-carboxylate is CC(C)OC(=O)c1c(-c2ccc(CO)c(CO)c2)csc1N.
What is the InChIKey of propan-2-yl 2-amino-4-[3,4-bis(hydroxymethyl)phenyl]thiophene-3-carboxylate?
The InChIKey is YYWBPSYCWFLOLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO4S/c1-9(2)21-16(20)14-13(8-22-15(14)17)10-3-4-11(6-18)12(5-10)7-19/h3-5,8-9,18-19H,6-7,17H2,1-2H3.
What are the key properties of propan-2-yl 2-amino-4-[3,4-bis(hydroxymethyl)phenyl]thiophene-3-carboxylate?
propan-2-yl 2-amino-4-[3,4-bis(hydroxymethyl)phenyl]thiophene-3-carboxylate has a molecular weight of 321.40 g/mol, XLogP of 2.55, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-amino-4-[3,4-bis(hydroxymethyl)phenyl]thiophene-3-carboxylate is sourced from PubChem (CID 71076017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).