C23H19Cl2NO3S — CID 4619833
ethyl 2-[3-(2,4-dichlorophenyl)prop-2-enoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate (PubChem CID 4619833) has the molecular formula C23H19Cl2NO3S and a molecular weight of 460.38 g/mol. Its IUPAC name is ethyl 2-[3-(2,4-dichlorophenyl)prop-2-enoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[3-(2,4-dichlorophenyl)prop-2-enoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4619833 |
| Molecular Formula | C23H19Cl2NO3S |
| Molecular Weight | 460.38 g/mol |
| Exact Mass | 459.05 |
| IUPAC Name | ethyl 2-[3-(2,4-dichlorophenyl)prop-2-enoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)C=Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H19Cl2NO3S/c1-3-29-23(28)21-18(15-6-4-14(2)5-7-15)13-30-22(21)26-20(27)11-9-16-8-10-17(24)12-19(16)25/h4-13H,3H2,1-2H3,(H,26,27) |
| InChIKey | KTAKDZGYYKXBIK-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.38 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|