C25H23Cl2NO3S — CID 28693397
ethyl 2-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]-4-(4-propan-2-ylphenyl)thiophene-3-carboxylate (PubChem CID 28693397) has the molecular formula C25H23Cl2NO3S and a molecular weight of 488.44 g/mol. Its IUPAC name is ethyl 2-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]-4-(4-propan-2-ylphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]-4-(4-propan-2-ylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 28693397 |
| Molecular Formula | C25H23Cl2NO3S |
| Molecular Weight | 488.44 g/mol |
| Exact Mass | 487.08 |
| IUPAC Name | ethyl 2-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]-4-(4-propan-2-ylphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C(C)C)cc2)csc1NC(=O)/C=C/c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C25H23Cl2NO3S/c1-4-31-25(30)23-20(17-7-5-16(6-8-17)15(2)3)14-32-24(23)28-22(29)12-10-18-9-11-19(26)13-21(18)27/h5-15H,4H2,1-3H3,(H,28,29)/b12-10+ |
| InChIKey | HSYDSMKMUPEENK-ZRDIBKRKSA-N |
| XLogP | 7.67 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.44 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|