C21H24Cl2N2O3S — CID 10479144
propan-2-yl 4-(3,4-dichlorophenyl)-2-[(2-piperidin-1-ylacetyl)amino]thiophene-3-carboxylate (PubChem CID 10479144) has the molecular formula C21H24Cl2N2O3S and a molecular weight of 455.41 g/mol. Its IUPAC name is propan-2-yl 4-(3,4-dichlorophenyl)-2-[(2-piperidin-1-ylacetyl)amino]thiophene-3-carboxylate.
| Compound Name | propan-2-yl 4-(3,4-dichlorophenyl)-2-[(2-piperidin-1-ylacetyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 10479144 |
| Molecular Formula | C21H24Cl2N2O3S |
| Molecular Weight | 455.41 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | propan-2-yl 4-(3,4-dichlorophenyl)-2-[(2-piperidin-1-ylacetyl)amino]thiophene-3-carboxylate |
| SMILES | CC(C)OC(=O)c1c(-c2ccc(Cl)c(Cl)c2)csc1NC(=O)CN1CCCCC1 |
| InChI | InChI=1S/C21H24Cl2N2O3S/c1-13(2)28-21(27)19-15(14-6-7-16(22)17(23)10-14)12-29-20(19)24-18(26)11-25-8-4-3-5-9-25/h6-7,10,12-13H,3-5,8-9,11H2,1-2H3,(H,24,26) |
| InChIKey | NZBHMHQGHBEQMP-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.41 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|