C25H27N3O5S2 — CID 17378458
methyl 2-[[2-[4-(benzenesulfonyl)piperazin-1-yl]acetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate (PubChem CID 17378458) has the molecular formula C25H27N3O5S2 and a molecular weight of 513.64 g/mol. Its IUPAC name is methyl 2-[[2-[4-(benzenesulfonyl)piperazin-1-yl]acetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[4-(benzenesulfonyl)piperazin-1-yl]acetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 17378458 |
| Molecular Formula | C25H27N3O5S2 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.14 |
| IUPAC Name | methyl 2-[[2-[4-(benzenesulfonyl)piperazin-1-yl]acetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)CN1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C25H27N3O5S2/c1-18-8-10-19(11-9-18)21-17-34-24(23(21)25(30)33-2)26-22(29)16-27-12-14-28(15-13-27)35(31,32)20-6-4-3-5-7-20/h3-11,17H,12-16H2,1-2H3,(H,26,29) |
| InChIKey | XRZZWZKUDQZION-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|