C26H28ClN3O5S2 — CID 22197096
methyl 2-[[2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]acetyl]amino]-4-(2,5-dimethylphenyl)thiophene-3-carboxylate (PubChem CID 22197096) has the molecular formula C26H28ClN3O5S2 and a molecular weight of 562.11 g/mol. Its IUPAC name is methyl 2-[[2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]acetyl]amino]-4-(2,5-dimethylphenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]acetyl]amino]-4-(2,5-dimethylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 22197096 |
| Molecular Formula | C26H28ClN3O5S2 |
| Molecular Weight | 562.11 g/mol |
| Exact Mass | 561.12 |
| IUPAC Name | methyl 2-[[2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]acetyl]amino]-4-(2,5-dimethylphenyl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2cc(C)ccc2C)csc1NC(=O)CN1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C26H28ClN3O5S2/c1-17-4-5-18(2)21(14-17)22-16-36-25(24(22)26(32)35-3)28-23(31)15-29-10-12-30(13-11-29)37(33,34)20-8-6-19(27)7-9-20/h4-9,14,16H,10-13,15H2,1-3H3,(H,28,31) |
| InChIKey | JDJGCJJJNWLCMG-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.11 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|