C25H33N3O5S2 — CID 22197163
methyl 2-[[2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]acetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 22197163) has the molecular formula C25H33N3O5S2 and a molecular weight of 519.69 g/mol. Its IUPAC name is methyl 2-[[2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]acetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]acetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 22197163 |
| Molecular Formula | C25H33N3O5S2 |
| Molecular Weight | 519.69 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | methyl 2-[[2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]acetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)CN2CCN(S(=O)(=O)c3ccc(C)cc3)CC2)sc2c1CCCCCC2 |
| InChI | InChI=1S/C25H33N3O5S2/c1-18-9-11-19(12-10-18)35(31,32)28-15-13-27(14-16-28)17-22(29)26-24-23(25(30)33-2)20-7-5-3-4-6-8-21(20)34-24/h9-12H,3-8,13-17H2,1-2H3,(H,26,29) |
| InChIKey | PQLUJSIYVAUEQJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.69 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |