C23H29N3O4S3 — CID 19680493
methyl 2-[(4-pyrrolidin-1-ylsulfonylphenyl)carbamothioylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 19680493) has the molecular formula C23H29N3O4S3 and a molecular weight of 507.70 g/mol. Its IUPAC name is methyl 2-[(4-pyrrolidin-1-ylsulfonylphenyl)carbamothioylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[(4-pyrrolidin-1-ylsulfonylphenyl)carbamothioylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19680493 |
| Molecular Formula | C23H29N3O4S3 |
| Molecular Weight | 507.70 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | methyl 2-[(4-pyrrolidin-1-ylsulfonylphenyl)carbamothioylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=S)Nc2ccc(S(=O)(=O)N3CCCC3)cc2)sc2c1CCCCCC2 |
| InChI | InChI=1S/C23H29N3O4S3/c1-30-22(27)20-18-8-4-2-3-5-9-19(18)32-21(20)25-23(31)24-16-10-12-17(13-11-16)33(28,29)26-14-6-7-15-26/h10-13H,2-9,14-15H2,1H3,(H2,24,25,31) |
| InChIKey | CBHZFWHZILAGEJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.70 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|