C25H33N3O3S — CID 22200612
methyl 2-[[2-[4-(2-methylphenyl)piperazin-1-yl]acetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 22200612) has the molecular formula C25H33N3O3S and a molecular weight of 455.62 g/mol. Its IUPAC name is methyl 2-[[2-[4-(2-methylphenyl)piperazin-1-yl]acetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[4-(2-methylphenyl)piperazin-1-yl]acetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 22200612 |
| Molecular Formula | C25H33N3O3S |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | methyl 2-[[2-[4-(2-methylphenyl)piperazin-1-yl]acetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)CN2CCN(c3ccccc3C)CC2)sc2c1CCCCCC2 |
| InChI | InChI=1S/C25H33N3O3S/c1-18-9-7-8-11-20(18)28-15-13-27(14-16-28)17-22(29)26-24-23(25(30)31-2)19-10-5-3-4-6-12-21(19)32-24/h7-9,11H,3-6,10,12-17H2,1-2H3,(H,26,29) |
| InChIKey | RRHXSMZEQFXLDK-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |