C20H28N2O7S — CID 17481838
methyl 2-[[2-(azepan-1-yl)acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate;oxalic acid (PubChem CID 17481838) has the molecular formula C20H28N2O7S and a molecular weight of 440.52 g/mol. Its IUPAC name is methyl 2-[[2-(azepan-1-yl)acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate;oxalic acid.
| Compound Name | methyl 2-[[2-(azepan-1-yl)acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate;oxalic acid |
|---|---|
| PubChem CID | 17481838 |
| Molecular Formula | C20H28N2O7S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | methyl 2-[[2-(azepan-1-yl)acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate;oxalic acid |
| SMILES | COC(=O)c1c(NC(=O)CN2CCCCCC2)sc2c1CCCC2.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H26N2O3S.C2H2O4/c1-23-18(22)16-13-8-4-5-9-14(13)24-17(16)19-15(21)12-20-10-6-2-3-7-11-20;3-1(4)2(5)6/h2-12H2,1H3,(H,19,21);(H,3,4)(H,5,6) |
| InChIKey | ZCSPOMVTTVHPII-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|