C25H33N3O2S2 — CID 19655115
methyl 2-[[4-(2,3-dimethylphenyl)piperazine-1-carbothioyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 19655115) has the molecular formula C25H33N3O2S2 and a molecular weight of 471.69 g/mol. Its IUPAC name is methyl 2-[[4-(2,3-dimethylphenyl)piperazine-1-carbothioyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[[4-(2,3-dimethylphenyl)piperazine-1-carbothioyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19655115 |
| Molecular Formula | C25H33N3O2S2 |
| Molecular Weight | 471.69 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | methyl 2-[[4-(2,3-dimethylphenyl)piperazine-1-carbothioyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=S)N2CCN(c3cccc(C)c3C)CC2)sc2c1CCCCCC2 |
| InChI | InChI=1S/C25H33N3O2S2/c1-17-9-8-11-20(18(17)2)27-13-15-28(16-14-27)25(31)26-23-22(24(29)30-3)19-10-6-4-5-7-12-21(19)32-23/h8-9,11H,4-7,10,12-16H2,1-3H3,(H,26,31) |
| InChIKey | XHUUISJQJFHUCB-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.69 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|