C22H29N3O3S — CID 22199002
methyl 4-(2,5-dimethylphenyl)-2-[[2-(4-ethylpiperazin-1-yl)acetyl]amino]thiophene-3-carboxylate (PubChem CID 22199002) has the molecular formula C22H29N3O3S and a molecular weight of 415.56 g/mol. Its IUPAC name is methyl 4-(2,5-dimethylphenyl)-2-[[2-(4-ethylpiperazin-1-yl)acetyl]amino]thiophene-3-carboxylate.
| Compound Name | methyl 4-(2,5-dimethylphenyl)-2-[[2-(4-ethylpiperazin-1-yl)acetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 22199002 |
| Molecular Formula | C22H29N3O3S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | methyl 4-(2,5-dimethylphenyl)-2-[[2-(4-ethylpiperazin-1-yl)acetyl]amino]thiophene-3-carboxylate |
| SMILES | CCN1CCN(CC(=O)Nc2scc(-c3cc(C)ccc3C)c2C(=O)OC)CC1 |
| InChI | InChI=1S/C22H29N3O3S/c1-5-24-8-10-25(11-9-24)13-19(26)23-21-20(22(27)28-4)18(14-29-21)17-12-15(2)6-7-16(17)3/h6-7,12,14H,5,8-11,13H2,1-4H3,(H,23,26) |
| InChIKey | IBGMRXHAVVVHBC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|