C28H31N3O4S — CID 22197390
methyl 2-[[2-[4-(4-acetylphenyl)piperazin-1-yl]acetyl]amino]-4-(2,5-dimethylphenyl)thiophene-3-carboxylate (PubChem CID 22197390) has the molecular formula C28H31N3O4S and a molecular weight of 505.64 g/mol. Its IUPAC name is methyl 2-[[2-[4-(4-acetylphenyl)piperazin-1-yl]acetyl]amino]-4-(2,5-dimethylphenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[4-(4-acetylphenyl)piperazin-1-yl]acetyl]amino]-4-(2,5-dimethylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 22197390 |
| Molecular Formula | C28H31N3O4S |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | methyl 2-[[2-[4-(4-acetylphenyl)piperazin-1-yl]acetyl]amino]-4-(2,5-dimethylphenyl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2cc(C)ccc2C)csc1NC(=O)CN1CCN(c2ccc(C(C)=O)cc2)CC1 |
| InChI | InChI=1S/C28H31N3O4S/c1-18-5-6-19(2)23(15-18)24-17-36-27(26(24)28(34)35-4)29-25(33)16-30-11-13-31(14-12-30)22-9-7-21(8-10-22)20(3)32/h5-10,15,17H,11-14,16H2,1-4H3,(H,29,33) |
| InChIKey | IHYMKAWEPFJZHI-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|