C18H18NO5S- — CID 4748172
4-[[4-(2,5-dimethylphenyl)-3-methoxycarbonylthiophen-2-yl]amino]-4-oxobutanoate (PubChem CID 4748172) has the molecular formula C18H18NO5S- and a molecular weight of 360.41 g/mol. Its IUPAC name is 4-[[4-(2,5-dimethylphenyl)-3-methoxycarbonylthiophen-2-yl]amino]-4-oxobutanoate.
| Compound Name | 4-[[4-(2,5-dimethylphenyl)-3-methoxycarbonylthiophen-2-yl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 4748172 |
| Molecular Formula | C18H18NO5S- |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 4-[[4-(2,5-dimethylphenyl)-3-methoxycarbonylthiophen-2-yl]amino]-4-oxobutanoate |
| SMILES | COC(=O)c1c(-c2cc(C)ccc2C)csc1NC(=O)CCC(=O)[O-] |
| InChI | InChI=1S/C18H19NO5S/c1-10-4-5-11(2)12(8-10)13-9-25-17(16(13)18(23)24-3)19-14(20)6-7-15(21)22/h4-5,8-9H,6-7H2,1-3H3,(H,19,20)(H,21,22)/p-1 |
| InChIKey | KPHAHBCNTZWQLE-UHFFFAOYSA-M |
| XLogP | 2.29 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|