C22H24NO5S- — CID 7058258
cis-(1S,2R)-2-[[4-(2,5-dimethylphenyl)-3-methoxycarbonylthiophen-2-yl]carbamoyl]cyclohexane-1-carboxylate (PubChem CID 7058258) has the molecular formula C22H24NO5S- and a molecular weight of 414.50 g/mol. Its IUPAC name is cis-(1S,2R)-2-[[4-(2,5-dimethylphenyl)-3-methoxycarbonylthiophen-2-yl]carbamoyl]cyclohexane-1-carboxylate.
| Compound Name | cis-(1S,2R)-2-[[4-(2,5-dimethylphenyl)-3-methoxycarbonylthiophen-2-yl]carbamoyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 7058258 |
| Molecular Formula | C22H24NO5S- |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | cis-(1S,2R)-2-[[4-(2,5-dimethylphenyl)-3-methoxycarbonylthiophen-2-yl]carbamoyl]cyclohexane-1-carboxylate |
| SMILES | COC(=O)c1c(-c2cc(C)ccc2C)csc1NC(=O)[C@@H]1CCCC[C@@H]1C(=O)[O-] |
| InChI | InChI=1S/C22H25NO5S/c1-12-8-9-13(2)16(10-12)17-11-29-20(18(17)22(27)28-3)23-19(24)14-6-4-5-7-15(14)21(25)26/h8-11,14-15H,4-7H2,1-3H3,(H,23,24)(H,25,26)/p-1/t14-,15+/m1/s1 |
| InChIKey | WJGWGNCAMCGDBK-CABCVRRESA-M |
| XLogP | 3.31 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|