C23H26NO5S- — CID 7058279
trans-(1R,2R)-2-[[4-(3,4-dimethylphenyl)-3-ethoxycarbonylthiophen-2-yl]carbamoyl]cyclohexane-1-carboxylate (PubChem CID 7058279) has the molecular formula C23H26NO5S- and a molecular weight of 428.53 g/mol. Its IUPAC name is trans-(1R,2R)-2-[[4-(3,4-dimethylphenyl)-3-ethoxycarbonylthiophen-2-yl]carbamoyl]cyclohexane-1-carboxylate.
| Compound Name | trans-(1R,2R)-2-[[4-(3,4-dimethylphenyl)-3-ethoxycarbonylthiophen-2-yl]carbamoyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 7058279 |
| Molecular Formula | C23H26NO5S- |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | trans-(1R,2R)-2-[[4-(3,4-dimethylphenyl)-3-ethoxycarbonylthiophen-2-yl]carbamoyl]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C)c(C)c2)csc1NC(=O)[C@@H]1CCCC[C@H]1C(=O)[O-] |
| InChI | InChI=1S/C23H27NO5S/c1-4-29-23(28)19-18(15-10-9-13(2)14(3)11-15)12-30-21(19)24-20(25)16-7-5-6-8-17(16)22(26)27/h9-12,16-17H,4-8H2,1-3H3,(H,24,25)(H,26,27)/p-1/t16-,17-/m1/s1 |
| InChIKey | QMMPQHZEHLOIKF-IAGOWNOFSA-M |
| XLogP | 3.70 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|