C22H25NO5S — CID 1013046
cis-(1S,2R)-2-[[3-ethoxycarbonyl-4-(4-methylphenyl)thiophen-2-yl]carbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 1013046) has the molecular formula C22H25NO5S and a molecular weight of 415.51 g/mol. Its IUPAC name is cis-(1S,2R)-2-[[3-ethoxycarbonyl-4-(4-methylphenyl)thiophen-2-yl]carbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | cis-(1S,2R)-2-[[3-ethoxycarbonyl-4-(4-methylphenyl)thiophen-2-yl]carbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 1013046 |
| Molecular Formula | C22H25NO5S |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | cis-(1S,2R)-2-[[3-ethoxycarbonyl-4-(4-methylphenyl)thiophen-2-yl]carbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | CCOC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)[C@@H]1CCCC[C@@H]1C(=O)O |
| InChI | InChI=1S/C22H25NO5S/c1-3-28-22(27)18-17(14-10-8-13(2)9-11-14)12-29-20(18)23-19(24)15-6-4-5-7-16(15)21(25)26/h8-12,15-16H,3-7H2,1-2H3,(H,23,24)(H,25,26)/t15-,16+/m1/s1 |
| InChIKey | ANRGOALEWVPWRX-CVEARBPZSA-N |
| XLogP | 4.73 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|