C25H29NO3S — CID 4564812
ethyl 2-(adamantane-1-carbonylamino)-4-(4-methylphenyl)thiophene-3-carboxylate (PubChem CID 4564812) has the molecular formula C25H29NO3S and a molecular weight of 423.58 g/mol. Its IUPAC name is ethyl 2-(adamantane-1-carbonylamino)-4-(4-methylphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-(adamantane-1-carbonylamino)-4-(4-methylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4564812 |
| Molecular Formula | C25H29NO3S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | ethyl 2-(adamantane-1-carbonylamino)-4-(4-methylphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H29NO3S/c1-3-29-23(27)21-20(19-6-4-15(2)5-7-19)14-30-22(21)26-24(28)25-11-16-8-17(12-25)10-18(9-16)13-25/h4-7,14,16-18H,3,8-13H2,1-2H3,(H,26,28) |
| InChIKey | ZZNJJKVIGFHIEH-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|