C21H29NO2S — CID 110826907
ethyl 2-(heptylamino)-4-(4-methylphenyl)thiophene-3-carboxylate (PubChem CID 110826907) has the molecular formula C21H29NO2S and a molecular weight of 359.54 g/mol. Its IUPAC name is ethyl 2-(heptylamino)-4-(4-methylphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-(heptylamino)-4-(4-methylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 110826907 |
| Molecular Formula | C21H29NO2S |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | ethyl 2-(heptylamino)-4-(4-methylphenyl)thiophene-3-carboxylate |
| SMILES | CCCCCCCNc1scc(-c2ccc(C)cc2)c1C(=O)OCC |
| InChI | InChI=1S/C21H29NO2S/c1-4-6-7-8-9-14-22-20-19(21(23)24-5-2)18(15-25-20)17-12-10-16(3)11-13-17/h10-13,15,22H,4-9,14H2,1-3H3 |
| InChIKey | UNHOMNIQWVSRBE-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|