C17H19NO3S — CID 734061
ethyl 2-acetamido-4-(3,4-dimethylphenyl)thiophene-3-carboxylate (PubChem CID 734061) has the molecular formula C17H19NO3S and a molecular weight of 317.41 g/mol. Its IUPAC name is ethyl 2-acetamido-4-(3,4-dimethylphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-acetamido-4-(3,4-dimethylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 734061 |
| Molecular Formula | C17H19NO3S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | ethyl 2-acetamido-4-(3,4-dimethylphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C)c(C)c2)csc1NC(C)=O |
| InChI | InChI=1S/C17H19NO3S/c1-5-21-17(20)15-14(9-22-16(15)18-12(4)19)13-7-6-10(2)11(3)8-13/h6-9H,5H2,1-4H3,(H,18,19) |
| InChIKey | JKGBLAYJCAXEKM-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|