C21H20N2O3S3 — CID 19187843
ethyl 4-(3,4-dimethylphenyl)-2-(thiophene-2-carbonylcarbamothioylamino)thiophene-3-carboxylate (PubChem CID 19187843) has the molecular formula C21H20N2O3S3 and a molecular weight of 444.60 g/mol. Its IUPAC name is ethyl 4-(3,4-dimethylphenyl)-2-(thiophene-2-carbonylcarbamothioylamino)thiophene-3-carboxylate.
| Compound Name | ethyl 4-(3,4-dimethylphenyl)-2-(thiophene-2-carbonylcarbamothioylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19187843 |
| Molecular Formula | C21H20N2O3S3 |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | ethyl 4-(3,4-dimethylphenyl)-2-(thiophene-2-carbonylcarbamothioylamino)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C)c(C)c2)csc1NC(=S)NC(=O)c1cccs1 |
| InChI | InChI=1S/C21H20N2O3S3/c1-4-26-20(25)17-15(14-8-7-12(2)13(3)10-14)11-29-19(17)23-21(27)22-18(24)16-6-5-9-28-16/h5-11H,4H2,1-3H3,(H2,22,23,24,27) |
| InChIKey | XRIGPSASLKCBII-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|