C21H21NO4S — CID 1009163
ethyl 4-(3,4-dimethylphenyl)-2-[(2-methylfuran-3-carbonyl)amino]thiophene-3-carboxylate (PubChem CID 1009163) has the molecular formula C21H21NO4S and a molecular weight of 383.47 g/mol. Its IUPAC name is ethyl 4-(3,4-dimethylphenyl)-2-[(2-methylfuran-3-carbonyl)amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(3,4-dimethylphenyl)-2-[(2-methylfuran-3-carbonyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 1009163 |
| Molecular Formula | C21H21NO4S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | ethyl 4-(3,4-dimethylphenyl)-2-[(2-methylfuran-3-carbonyl)amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C)c(C)c2)csc1NC(=O)c1ccoc1C |
| InChI | InChI=1S/C21H21NO4S/c1-5-25-21(24)18-17(15-7-6-12(2)13(3)10-15)11-27-20(18)22-19(23)16-8-9-26-14(16)4/h6-11H,5H2,1-4H3,(H,22,23) |
| InChIKey | DSVDWFMPIXMCRQ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|