C20H19NO4S — CID 4172263
ethyl 2-[(2-methylfuran-3-carbonyl)amino]-4-(4-methylphenyl)thiophene-3-carboxylate (PubChem CID 4172263) has the molecular formula C20H19NO4S and a molecular weight of 369.44 g/mol. Its IUPAC name is ethyl 2-[(2-methylfuran-3-carbonyl)amino]-4-(4-methylphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[(2-methylfuran-3-carbonyl)amino]-4-(4-methylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4172263 |
| Molecular Formula | C20H19NO4S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | ethyl 2-[(2-methylfuran-3-carbonyl)amino]-4-(4-methylphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)c1ccoc1C |
| InChI | InChI=1S/C20H19NO4S/c1-4-24-20(23)17-16(14-7-5-12(2)6-8-14)11-26-19(17)21-18(22)15-9-10-25-13(15)3/h5-11H,4H2,1-3H3,(H,21,22) |
| InChIKey | KXPITNDKCZUYEV-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|