C21H17F2NO3S — CID 2383903
ethyl 2-[(2,6-difluorobenzoyl)amino]-4-(4-methylphenyl)thiophene-3-carboxylate (PubChem CID 2383903) has the molecular formula C21H17F2NO3S and a molecular weight of 401.43 g/mol. Its IUPAC name is ethyl 2-[(2,6-difluorobenzoyl)amino]-4-(4-methylphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[(2,6-difluorobenzoyl)amino]-4-(4-methylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 2383903 |
| Molecular Formula | C21H17F2NO3S |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | ethyl 2-[(2,6-difluorobenzoyl)amino]-4-(4-methylphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C21H17F2NO3S/c1-3-27-21(26)17-14(13-9-7-12(2)8-10-13)11-28-20(17)24-19(25)18-15(22)5-4-6-16(18)23/h4-11H,3H2,1-2H3,(H,24,25) |
| InChIKey | JCNPACLLFYOONS-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|