C19H17NO4S — CID 2241755
methyl 4-(3,4-dimethylphenyl)-2-(furan-2-carbonylamino)thiophene-3-carboxylate (PubChem CID 2241755) has the molecular formula C19H17NO4S and a molecular weight of 355.42 g/mol. Its IUPAC name is methyl 4-(3,4-dimethylphenyl)-2-(furan-2-carbonylamino)thiophene-3-carboxylate.
| Compound Name | methyl 4-(3,4-dimethylphenyl)-2-(furan-2-carbonylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 2241755 |
| Molecular Formula | C19H17NO4S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | methyl 4-(3,4-dimethylphenyl)-2-(furan-2-carbonylamino)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(C)c(C)c2)csc1NC(=O)c1ccco1 |
| InChI | InChI=1S/C19H17NO4S/c1-11-6-7-13(9-12(11)2)14-10-25-18(16(14)19(22)23-3)20-17(21)15-5-4-8-24-15/h4-10H,1-3H3,(H,20,21) |
| InChIKey | DNATVZSLMCXNQN-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|