C18H14BrNO4S — CID 1000679
methyl 4-(4-bromophenyl)-2-[(5-methylfuran-2-carbonyl)amino]thiophene-3-carboxylate (PubChem CID 1000679) has the molecular formula C18H14BrNO4S and a molecular weight of 420.28 g/mol. Its IUPAC name is methyl 4-(4-bromophenyl)-2-[(5-methylfuran-2-carbonyl)amino]thiophene-3-carboxylate.
| Compound Name | methyl 4-(4-bromophenyl)-2-[(5-methylfuran-2-carbonyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 1000679 |
| Molecular Formula | C18H14BrNO4S |
| Molecular Weight | 420.28 g/mol |
| Exact Mass | 418.98 |
| IUPAC Name | methyl 4-(4-bromophenyl)-2-[(5-methylfuran-2-carbonyl)amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(Br)cc2)csc1NC(=O)c1ccc(C)o1 |
| InChI | InChI=1S/C18H14BrNO4S/c1-10-3-8-14(24-10)16(21)20-17-15(18(22)23-2)13(9-25-17)11-4-6-12(19)7-5-11/h3-9H,1-2H3,(H,20,21) |
| InChIKey | RDOQFXGABSNIMJ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.28 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|