C14H9BrCl3NO3S — CID 4280410
methyl 4-(4-bromophenyl)-2-[(2,2,2-trichloroacetyl)amino]thiophene-3-carboxylate (PubChem CID 4280410) has the molecular formula C14H9BrCl3NO3S and a molecular weight of 457.56 g/mol. Its IUPAC name is methyl 4-(4-bromophenyl)-2-[(2,2,2-trichloroacetyl)amino]thiophene-3-carboxylate.
| Compound Name | methyl 4-(4-bromophenyl)-2-[(2,2,2-trichloroacetyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4280410 |
| Molecular Formula | C14H9BrCl3NO3S |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 454.86 |
| IUPAC Name | methyl 4-(4-bromophenyl)-2-[(2,2,2-trichloroacetyl)amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(Br)cc2)csc1NC(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H9BrCl3NO3S/c1-22-12(20)10-9(7-2-4-8(15)5-3-7)6-23-11(10)19-13(21)14(16,17)18/h2-6H,1H3,(H,19,21) |
| InChIKey | MPZONWHFPIGXOE-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|