C21H10ClF16NO3S — CID 3420148
methyl 2-[(9-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoyl)amino]-4-phenylthiophene-3-carboxylate (PubChem CID 3420148) has the molecular formula C21H10ClF16NO3S and a molecular weight of 695.80 g/mol. Its IUPAC name is methyl 2-[(9-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoyl)amino]-4-phenylthiophene-3-carboxylate.
| Compound Name | methyl 2-[(9-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoyl)amino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 3420148 |
| Molecular Formula | C21H10ClF16NO3S |
| Molecular Weight | 695.80 g/mol |
| Exact Mass | 694.98 |
| IUPAC Name | methyl 2-[(9-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoyl)amino]-4-phenylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccccc2)csc1NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C21H10ClF16NO3S/c1-42-12(40)10-9(8-5-3-2-4-6-8)7-43-11(10)39-13(41)14(23,24)15(25,26)16(27,28)17(29,30)18(31,32)19(33,34)20(35,36)21(22,37)38/h2-7H,1H3,(H,39,41) |
| InChIKey | IKXDPOWIZNFNJV-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.80 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|