C24H25NO4S — CID 2241891
methyl 2-[[2-(2,4-dimethylphenoxy)acetyl]amino]-4-(3,4-dimethylphenyl)thiophene-3-carboxylate (PubChem CID 2241891) has the molecular formula C24H25NO4S and a molecular weight of 423.53 g/mol. Its IUPAC name is methyl 2-[[2-(2,4-dimethylphenoxy)acetyl]amino]-4-(3,4-dimethylphenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-(2,4-dimethylphenoxy)acetyl]amino]-4-(3,4-dimethylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 2241891 |
| Molecular Formula | C24H25NO4S |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | methyl 2-[[2-(2,4-dimethylphenoxy)acetyl]amino]-4-(3,4-dimethylphenyl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(C)c(C)c2)csc1NC(=O)COc1ccc(C)cc1C |
| InChI | InChI=1S/C24H25NO4S/c1-14-6-9-20(17(4)10-14)29-12-21(26)25-23-22(24(27)28-5)19(13-30-23)18-8-7-15(2)16(3)11-18/h6-11,13H,12H2,1-5H3,(H,25,26) |
| InChIKey | DLBVQXMQLPVWJC-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|