C25H27NO5S — CID 2241903
methyl 2-[[2-(2,5-dimethylphenoxy)acetyl]amino]-4-(4-propoxyphenyl)thiophene-3-carboxylate (PubChem CID 2241903) has the molecular formula C25H27NO5S and a molecular weight of 453.56 g/mol. Its IUPAC name is methyl 2-[[2-(2,5-dimethylphenoxy)acetyl]amino]-4-(4-propoxyphenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-(2,5-dimethylphenoxy)acetyl]amino]-4-(4-propoxyphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 2241903 |
| Molecular Formula | C25H27NO5S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | methyl 2-[[2-(2,5-dimethylphenoxy)acetyl]amino]-4-(4-propoxyphenyl)thiophene-3-carboxylate |
| SMILES | CCCOc1ccc(-c2csc(NC(=O)COc3cc(C)ccc3C)c2C(=O)OC)cc1 |
| InChI | InChI=1S/C25H27NO5S/c1-5-12-30-19-10-8-18(9-11-19)20-15-32-24(23(20)25(28)29-4)26-22(27)14-31-21-13-16(2)6-7-17(21)3/h6-11,13,15H,5,12,14H2,1-4H3,(H,26,27) |
| InChIKey | YLRFETBHOHFVBF-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|